C12H15ClO3 — CID 61380155
1-(3-chloro-4,5-dimethoxyphenyl)but-3-en-1-ol (PubChem CID 61380155) has the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. Its IUPAC name is 1-(3-chloro-4,5-dimethoxyphenyl)but-3-en-1-ol.
| Compound Name | 1-(3-chloro-4,5-dimethoxyphenyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 61380155 |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-(3-chloro-4,5-dimethoxyphenyl)but-3-en-1-ol |
| SMILES | C=CCC(O)c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C12H15ClO3/c1-4-5-10(14)8-6-9(13)12(16-3)11(7-8)15-2/h4,6-7,10,14H,1,5H2,2-3H3 |
| InChIKey | VFGLTBFOPSJDMA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|