C14H14BrClO3S — CID 62608419
2-(4-bromothiophen-2-yl)-1-(3-chloro-4,5-dimethoxyphenyl)ethanol (PubChem CID 62608419) has the molecular formula C14H14BrClO3S and a molecular weight of 377.69 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-(3-chloro-4,5-dimethoxyphenyl)ethanol.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-(3-chloro-4,5-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 62608419 |
| Molecular Formula | C14H14BrClO3S |
| Molecular Weight | 377.69 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-(3-chloro-4,5-dimethoxyphenyl)ethanol |
| SMILES | COc1cc(C(O)Cc2cc(Br)cs2)cc(Cl)c1OC |
| InChI | InChI=1S/C14H14BrClO3S/c1-18-13-4-8(3-11(16)14(13)19-2)12(17)6-10-5-9(15)7-20-10/h3-5,7,12,17H,6H2,1-2H3 |
| InChIKey | CHQMISYQSCPHAG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |