C14H15BrO3S — CID 115790186
2-(4-bromothiophen-2-yl)-1-(2,6-dimethoxyphenyl)ethanol (PubChem CID 115790186) has the molecular formula C14H15BrO3S and a molecular weight of 343.24 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-(2,6-dimethoxyphenyl)ethanol.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-(2,6-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 115790186 |
| Molecular Formula | C14H15BrO3S |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-(2,6-dimethoxyphenyl)ethanol |
| SMILES | COc1cccc(OC)c1C(O)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C14H15BrO3S/c1-17-12-4-3-5-13(18-2)14(12)11(16)7-10-6-9(15)8-19-10/h3-6,8,11,16H,7H2,1-2H3 |
| InChIKey | FMRYBKNWQHIGLX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |