C14H16BrClN2O2S — CID 105204619
[2-(3-bromothiophen-2-yl)-1-(3-chloro-4,5-dimethoxyphenyl)ethyl]hydrazine (PubChem CID 105204619) has the molecular formula C14H16BrClN2O2S and a molecular weight of 391.72 g/mol. Its IUPAC name is [2-(3-bromothiophen-2-yl)-1-(3-chloro-4,5-dimethoxyphenyl)ethyl]hydrazine.
| Compound Name | [2-(3-bromothiophen-2-yl)-1-(3-chloro-4,5-dimethoxyphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105204619 |
| Molecular Formula | C14H16BrClN2O2S |
| Molecular Weight | 391.72 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | [2-(3-bromothiophen-2-yl)-1-(3-chloro-4,5-dimethoxyphenyl)ethyl]hydrazine |
| SMILES | COc1cc(C(Cc2sccc2Br)NN)cc(Cl)c1OC |
| InChI | InChI=1S/C14H16BrClN2O2S/c1-19-12-6-8(5-10(16)14(12)20-2)11(18-17)7-13-9(15)3-4-21-13/h3-6,11,18H,7,17H2,1-2H3 |
| InChIKey | VOWIBKOAEAMSQX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|