C10H10Br2N2S2 — CID 105299585
1,2-bis(3-bromothiophen-2-yl)ethylhydrazine (PubChem CID 105299585) has the molecular formula C10H10Br2N2S2 and a molecular weight of 382.15 g/mol. Its IUPAC name is 1,2-bis(3-bromothiophen-2-yl)ethylhydrazine.
| Compound Name | 1,2-bis(3-bromothiophen-2-yl)ethylhydrazine |
|---|---|
| PubChem CID | 105299585 |
| Molecular Formula | C10H10Br2N2S2 |
| Molecular Weight | 382.15 g/mol |
| Exact Mass | 379.87 |
| IUPAC Name | 1,2-bis(3-bromothiophen-2-yl)ethylhydrazine |
| SMILES | NNC(Cc1sccc1Br)c1sccc1Br |
| InChI | InChI=1S/C10H10Br2N2S2/c11-6-1-3-15-9(6)5-8(14-13)10-7(12)2-4-16-10/h1-4,8,14H,5,13H2 |
| InChIKey | IHLSXZCPCVNDON-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.15 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|