C11H15BrN4S2 — CID 105299495
[2-(3-bromothiophen-2-yl)-1-(4-propylthiadiazol-5-yl)ethyl]hydrazine (PubChem CID 105299495) has the molecular formula C11H15BrN4S2 and a molecular weight of 347.31 g/mol. Its IUPAC name is [2-(3-bromothiophen-2-yl)-1-(4-propylthiadiazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(3-bromothiophen-2-yl)-1-(4-propylthiadiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105299495 |
| Molecular Formula | C11H15BrN4S2 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | [2-(3-bromothiophen-2-yl)-1-(4-propylthiadiazol-5-yl)ethyl]hydrazine |
| SMILES | CCCc1nnsc1C(Cc1sccc1Br)NN |
| InChI | InChI=1S/C11H15BrN4S2/c1-2-3-8-11(18-16-15-8)9(14-13)6-10-7(12)4-5-17-10/h4-5,9,14H,2-3,6,13H2,1H3 |
| InChIKey | URXIOJFUZZVNKG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|