C9H13N5S2 — CID 105324673
[1-(4-ethylthiadiazol-5-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105324673) has the molecular formula C9H13N5S2 and a molecular weight of 255.37 g/mol. Its IUPAC name is [1-(4-ethylthiadiazol-5-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(4-ethylthiadiazol-5-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105324673 |
| Molecular Formula | C9H13N5S2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | [1-(4-ethylthiadiazol-5-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | CCc1nnsc1C(Cc1nccs1)NN |
| InChI | InChI=1S/C9H13N5S2/c1-2-6-9(16-14-13-6)7(12-10)5-8-11-3-4-15-8/h3-4,7,12H,2,5,10H2,1H3 |
| InChIKey | TUUVSMHVQMMHOC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|