C15H20N4S — CID 105310750
[2-(2,3-dihydro-1H-inden-5-yl)-1-(4-ethylthiadiazol-5-yl)ethyl]hydrazine (PubChem CID 105310750) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-yl)-1-(4-ethylthiadiazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(2,3-dihydro-1H-inden-5-yl)-1-(4-ethylthiadiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105310750 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-yl)-1-(4-ethylthiadiazol-5-yl)ethyl]hydrazine |
| SMILES | CCc1nnsc1C(Cc1ccc2c(c1)CCC2)NN |
| InChI | InChI=1S/C15H20N4S/c1-2-13-15(20-19-18-13)14(17-16)9-10-6-7-11-4-3-5-12(11)8-10/h6-8,14,17H,2-5,9,16H2,1H3 |
| InChIKey | AVQWQTRWWOHEJD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|