C11H18N6S — CID 105321909
[2-(1-ethylimidazol-2-yl)-1-(4-ethylthiadiazol-5-yl)ethyl]hydrazine (PubChem CID 105321909) has the molecular formula C11H18N6S and a molecular weight of 266.37 g/mol. Its IUPAC name is [2-(1-ethylimidazol-2-yl)-1-(4-ethylthiadiazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(1-ethylimidazol-2-yl)-1-(4-ethylthiadiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105321909 |
| Molecular Formula | C11H18N6S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [2-(1-ethylimidazol-2-yl)-1-(4-ethylthiadiazol-5-yl)ethyl]hydrazine |
| SMILES | CCc1nnsc1C(Cc1nccn1CC)NN |
| InChI | InChI=1S/C11H18N6S/c1-3-8-11(18-16-15-8)9(14-12)7-10-13-5-6-17(10)4-2/h5-6,9,14H,3-4,7,12H2,1-2H3 |
| InChIKey | XYBNEWKHWDHPHU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|