C12H20N6S — CID 105321812
[2-(1-ethylimidazol-2-yl)-1-(4-propylthiadiazol-5-yl)ethyl]hydrazine (PubChem CID 105321812) has the molecular formula C12H20N6S and a molecular weight of 280.40 g/mol. Its IUPAC name is [2-(1-ethylimidazol-2-yl)-1-(4-propylthiadiazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(1-ethylimidazol-2-yl)-1-(4-propylthiadiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105321812 |
| Molecular Formula | C12H20N6S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [2-(1-ethylimidazol-2-yl)-1-(4-propylthiadiazol-5-yl)ethyl]hydrazine |
| SMILES | CCCc1nnsc1C(Cc1nccn1CC)NN |
| InChI | InChI=1S/C12H20N6S/c1-3-5-9-12(19-17-16-9)10(15-13)8-11-14-6-7-18(11)4-2/h6-7,10,15H,3-5,8,13H2,1-2H3 |
| InChIKey | CIFHJPOATJSRGL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|