C12H17BrN4S — CID 105321894
[1-(5-bromo-4-methylthiophen-2-yl)-2-(1-ethylimidazol-2-yl)ethyl]hydrazine (PubChem CID 105321894) has the molecular formula C12H17BrN4S and a molecular weight of 329.27 g/mol. Its IUPAC name is [1-(5-bromo-4-methylthiophen-2-yl)-2-(1-ethylimidazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(5-bromo-4-methylthiophen-2-yl)-2-(1-ethylimidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105321894 |
| Molecular Formula | C12H17BrN4S |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | [1-(5-bromo-4-methylthiophen-2-yl)-2-(1-ethylimidazol-2-yl)ethyl]hydrazine |
| SMILES | CCn1ccnc1CC(NN)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C12H17BrN4S/c1-3-17-5-4-15-11(17)7-9(16-14)10-6-8(2)12(13)18-10/h4-6,9,16H,3,7,14H2,1-2H3 |
| InChIKey | SIAQJQPUKGCBLS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|