C13H16BrIN4 — CID 114027386
[1-(2-bromo-5-iodophenyl)-2-(1-ethylimidazol-2-yl)ethyl]hydrazine (PubChem CID 114027386) has the molecular formula C13H16BrIN4 and a molecular weight of 435.11 g/mol. Its IUPAC name is [1-(2-bromo-5-iodophenyl)-2-(1-ethylimidazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(2-bromo-5-iodophenyl)-2-(1-ethylimidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 114027386 |
| Molecular Formula | C13H16BrIN4 |
| Molecular Weight | 435.11 g/mol |
| Exact Mass | 433.96 |
| IUPAC Name | [1-(2-bromo-5-iodophenyl)-2-(1-ethylimidazol-2-yl)ethyl]hydrazine |
| SMILES | CCn1ccnc1CC(NN)c1cc(I)ccc1Br |
| InChI | InChI=1S/C13H16BrIN4/c1-2-19-6-5-17-13(19)8-12(18-16)10-7-9(15)3-4-11(10)14/h3-7,12,18H,2,8,16H2,1H3 |
| InChIKey | VWERTHUQJSNWIU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.11 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|