C9H12N6S — CID 105308737
[(4-ethylthiadiazol-5-yl)-pyrazin-2-ylmethyl]hydrazine (PubChem CID 105308737) has the molecular formula C9H12N6S and a molecular weight of 236.30 g/mol. Its IUPAC name is [(4-ethylthiadiazol-5-yl)-pyrazin-2-ylmethyl]hydrazine.
| Compound Name | [(4-ethylthiadiazol-5-yl)-pyrazin-2-ylmethyl]hydrazine |
|---|---|
| PubChem CID | 105308737 |
| Molecular Formula | C9H12N6S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | [(4-ethylthiadiazol-5-yl)-pyrazin-2-ylmethyl]hydrazine |
| SMILES | CCc1nnsc1C(NN)c1cnccn1 |
| InChI | InChI=1S/C9H12N6S/c1-2-6-9(16-15-14-6)8(13-10)7-5-11-3-4-12-7/h3-5,8,13H,2,10H2,1H3 |
| InChIKey | NGEBXUBEODJNMZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|