C10H14N6OS — CID 105332698
[(4-ethylthiadiazol-5-yl)-(3-methoxypyrazin-2-yl)methyl]hydrazine (PubChem CID 105332698) has the molecular formula C10H14N6OS and a molecular weight of 266.33 g/mol. Its IUPAC name is [(4-ethylthiadiazol-5-yl)-(3-methoxypyrazin-2-yl)methyl]hydrazine.
| Compound Name | [(4-ethylthiadiazol-5-yl)-(3-methoxypyrazin-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105332698 |
| Molecular Formula | C10H14N6OS |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [(4-ethylthiadiazol-5-yl)-(3-methoxypyrazin-2-yl)methyl]hydrazine |
| SMILES | CCc1nnsc1C(NN)c1nccnc1OC |
| InChI | InChI=1S/C10H14N6OS/c1-3-6-9(18-16-15-6)7(14-11)8-10(17-2)13-5-4-12-8/h4-5,7,14H,3,11H2,1-2H3 |
| InChIKey | KFEMSCFNWWRVNJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|