C10H14N4S2 — CID 105318787
[(4-ethylthiadiazol-5-yl)-(5-methylthiophen-2-yl)methyl]hydrazine (PubChem CID 105318787) has the molecular formula C10H14N4S2 and a molecular weight of 254.38 g/mol. Its IUPAC name is [(4-ethylthiadiazol-5-yl)-(5-methylthiophen-2-yl)methyl]hydrazine.
| Compound Name | [(4-ethylthiadiazol-5-yl)-(5-methylthiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105318787 |
| Molecular Formula | C10H14N4S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [(4-ethylthiadiazol-5-yl)-(5-methylthiophen-2-yl)methyl]hydrazine |
| SMILES | CCc1nnsc1C(NN)c1ccc(C)s1 |
| InChI | InChI=1S/C10H14N4S2/c1-3-7-10(16-14-13-7)9(12-11)8-5-4-6(2)15-8/h4-5,9,12H,3,11H2,1-2H3 |
| InChIKey | GEVGOVUSUYOCNK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|