C11H12F3N5S — CID 102710567
[(4-ethylthiadiazol-5-yl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]hydrazine (PubChem CID 102710567) has the molecular formula C11H12F3N5S and a molecular weight of 303.31 g/mol. Its IUPAC name is [(4-ethylthiadiazol-5-yl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]hydrazine.
| Compound Name | [(4-ethylthiadiazol-5-yl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]hydrazine |
|---|---|
| PubChem CID | 102710567 |
| Molecular Formula | C11H12F3N5S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | [(4-ethylthiadiazol-5-yl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]hydrazine |
| SMILES | CCc1nnsc1C(NN)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C11H12F3N5S/c1-2-8-10(20-19-18-8)9(17-15)6-5-16-4-3-7(6)11(12,13)14/h3-5,9,17H,2,15H2,1H3 |
| InChIKey | HABJPDRHHKCWSF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|