C12H12F3N3S — CID 105145381
(4-ethylthiadiazol-5-yl)-[2-(trifluoromethyl)phenyl]methanamine (PubChem CID 105145381) has the molecular formula C12H12F3N3S and a molecular weight of 287.31 g/mol. Its IUPAC name is (4-ethylthiadiazol-5-yl)-[2-(trifluoromethyl)phenyl]methanamine.
| Compound Name | (4-ethylthiadiazol-5-yl)-[2-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 105145381 |
| Molecular Formula | C12H12F3N3S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | (4-ethylthiadiazol-5-yl)-[2-(trifluoromethyl)phenyl]methanamine |
| SMILES | CCc1nnsc1C(N)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3N3S/c1-2-9-11(19-18-17-9)10(16)7-5-3-4-6-8(7)12(13,14)15/h3-6,10H,2,16H2,1H3 |
| InChIKey | VAMYVJOCQZTUDX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |