C12H10F4N2OS — CID 107292136
(4-ethylthiadiazol-5-yl)-[4-fluoro-3-(trifluoromethyl)phenyl]methanol (PubChem CID 107292136) has the molecular formula C12H10F4N2OS and a molecular weight of 306.28 g/mol. Its IUPAC name is (4-ethylthiadiazol-5-yl)-[4-fluoro-3-(trifluoromethyl)phenyl]methanol.
| Compound Name | (4-ethylthiadiazol-5-yl)-[4-fluoro-3-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 107292136 |
| Molecular Formula | C12H10F4N2OS |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (4-ethylthiadiazol-5-yl)-[4-fluoro-3-(trifluoromethyl)phenyl]methanol |
| SMILES | CCc1nnsc1C(O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F4N2OS/c1-2-9-11(20-18-17-9)10(19)6-3-4-8(13)7(5-6)12(14,15)16/h3-5,10,19H,2H2,1H3 |
| InChIKey | AOVCOELARSNEIP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |