C13H10F4N2O2 — CID 104514714
[4-fluoro-3-(trifluoromethyl)phenyl]-(3-methoxypyrazin-2-yl)methanol (PubChem CID 104514714) has the molecular formula C13H10F4N2O2 and a molecular weight of 302.23 g/mol. Its IUPAC name is [4-fluoro-3-(trifluoromethyl)phenyl]-(3-methoxypyrazin-2-yl)methanol.
| Compound Name | [4-fluoro-3-(trifluoromethyl)phenyl]-(3-methoxypyrazin-2-yl)methanol |
|---|---|
| PubChem CID | 104514714 |
| Molecular Formula | C13H10F4N2O2 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | [4-fluoro-3-(trifluoromethyl)phenyl]-(3-methoxypyrazin-2-yl)methanol |
| SMILES | COc1nccnc1C(O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F4N2O2/c1-21-12-10(18-4-5-19-12)11(20)7-2-3-9(14)8(6-7)13(15,16)17/h2-6,11,20H,1H3 |
| InChIKey | KVCXIUDOPCSIEV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |