C16H16F3N — CID 43197636
(4-ethylphenyl)-[2-(trifluoromethyl)phenyl]methanamine (PubChem CID 43197636) has the molecular formula C16H16F3N and a molecular weight of 279.31 g/mol. Its IUPAC name is (4-ethylphenyl)-[2-(trifluoromethyl)phenyl]methanamine.
| Compound Name | (4-ethylphenyl)-[2-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 43197636 |
| Molecular Formula | C16H16F3N |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (4-ethylphenyl)-[2-(trifluoromethyl)phenyl]methanamine |
| SMILES | CCc1ccc(C(N)c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F3N/c1-2-11-7-9-12(10-8-11)15(20)13-5-3-4-6-14(13)16(17,18)19/h3-10,15H,2,20H2,1H3 |
| InChIKey | JEXSLRKUBQQHKC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |