C15H13BrF3N — CID 115853868
(3-bromo-4-methylphenyl)-[2-(trifluoromethyl)phenyl]methanamine (PubChem CID 115853868) has the molecular formula C15H13BrF3N and a molecular weight of 344.17 g/mol. Its IUPAC name is (3-bromo-4-methylphenyl)-[2-(trifluoromethyl)phenyl]methanamine.
| Compound Name | (3-bromo-4-methylphenyl)-[2-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 115853868 |
| Molecular Formula | C15H13BrF3N |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | (3-bromo-4-methylphenyl)-[2-(trifluoromethyl)phenyl]methanamine |
| SMILES | Cc1ccc(C(N)c2ccccc2C(F)(F)F)cc1Br |
| InChI | InChI=1S/C15H13BrF3N/c1-9-6-7-10(8-13(9)16)14(20)11-4-2-3-5-12(11)15(17,18)19/h2-8,14H,20H2,1H3 |
| InChIKey | OTPIWFLPYLQPEA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |