C13H19N5S — CID 105149972
N-[(4-tert-butylthiadiazol-5-yl)-pyrazin-2-ylmethyl]ethanamine (PubChem CID 105149972) has the molecular formula C13H19N5S and a molecular weight of 277.40 g/mol. Its IUPAC name is N-[(4-tert-butylthiadiazol-5-yl)-pyrazin-2-ylmethyl]ethanamine.
| Compound Name | N-[(4-tert-butylthiadiazol-5-yl)-pyrazin-2-ylmethyl]ethanamine |
|---|---|
| PubChem CID | 105149972 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-[(4-tert-butylthiadiazol-5-yl)-pyrazin-2-ylmethyl]ethanamine |
| SMILES | CCNC(c1cnccn1)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C13H19N5S/c1-5-15-10(9-8-14-6-7-16-9)11-12(13(2,3)4)17-18-19-11/h6-8,10,15H,5H2,1-4H3 |
| InChIKey | ONNZPKUOYFNWJK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |