C16H22FN3S — CID 107130488
N-[(4-tert-butylthiadiazol-5-yl)-(3-fluoro-4-methylphenyl)methyl]ethanamine (PubChem CID 107130488) has the molecular formula C16H22FN3S and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[(4-tert-butylthiadiazol-5-yl)-(3-fluoro-4-methylphenyl)methyl]ethanamine.
| Compound Name | N-[(4-tert-butylthiadiazol-5-yl)-(3-fluoro-4-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 107130488 |
| Molecular Formula | C16H22FN3S |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-[(4-tert-butylthiadiazol-5-yl)-(3-fluoro-4-methylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(C)c(F)c1)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C16H22FN3S/c1-6-18-13(11-8-7-10(2)12(17)9-11)14-15(16(3,4)5)19-20-21-14/h7-9,13,18H,6H2,1-5H3 |
| InChIKey | XUQMMKFITPVRGE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |