C14H19FN4S — CID 105302694
[(4-tert-butylthiadiazol-5-yl)-(4-fluoro-3-methylphenyl)methyl]hydrazine (PubChem CID 105302694) has the molecular formula C14H19FN4S and a molecular weight of 294.40 g/mol. Its IUPAC name is [(4-tert-butylthiadiazol-5-yl)-(4-fluoro-3-methylphenyl)methyl]hydrazine.
| Compound Name | [(4-tert-butylthiadiazol-5-yl)-(4-fluoro-3-methylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105302694 |
| Molecular Formula | C14H19FN4S |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | [(4-tert-butylthiadiazol-5-yl)-(4-fluoro-3-methylphenyl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)c2snnc2C(C)(C)C)ccc1F |
| InChI | InChI=1S/C14H19FN4S/c1-8-7-9(5-6-10(8)15)11(17-16)12-13(14(2,3)4)18-19-20-12/h5-7,11,17H,16H2,1-4H3 |
| InChIKey | IOWQXDBMOZOQKX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|