C15H20ClN3S — CID 107561888
1-(4-tert-butylthiadiazol-5-yl)-1-(3-chloro-4-methylphenyl)-N-methylmethanamine (PubChem CID 107561888) has the molecular formula C15H20ClN3S and a molecular weight of 309.87 g/mol. Its IUPAC name is 1-(4-tert-butylthiadiazol-5-yl)-1-(3-chloro-4-methylphenyl)-N-methylmethanamine.
| Compound Name | 1-(4-tert-butylthiadiazol-5-yl)-1-(3-chloro-4-methylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107561888 |
| Molecular Formula | C15H20ClN3S |
| Molecular Weight | 309.87 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-(4-tert-butylthiadiazol-5-yl)-1-(3-chloro-4-methylphenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(C)c(Cl)c1)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C15H20ClN3S/c1-9-6-7-10(8-11(9)16)12(17-5)13-14(15(2,3)4)18-19-20-13/h6-8,12,17H,1-5H3 |
| InChIKey | PUNBUPCOUVIFSZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |