C13H14Cl2N2OS — CID 105133332
(4-tert-butylthiadiazol-5-yl)-(3,4-dichlorophenyl)methanol (PubChem CID 105133332) has the molecular formula C13H14Cl2N2OS and a molecular weight of 317.24 g/mol. Its IUPAC name is (4-tert-butylthiadiazol-5-yl)-(3,4-dichlorophenyl)methanol.
| Compound Name | (4-tert-butylthiadiazol-5-yl)-(3,4-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 105133332 |
| Molecular Formula | C13H14Cl2N2OS |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | (4-tert-butylthiadiazol-5-yl)-(3,4-dichlorophenyl)methanol |
| SMILES | CC(C)(C)c1nnsc1C(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2N2OS/c1-13(2,3)12-11(19-17-16-12)10(18)7-4-5-8(14)9(15)6-7/h4-6,10,18H,1-3H3 |
| InChIKey | YUUHPKKJQXHDBD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |