C14H16Cl2N2OS — CID 105086800
1-(4-tert-butylthiadiazol-5-yl)-2-(2,4-dichlorophenyl)ethanol (PubChem CID 105086800) has the molecular formula C14H16Cl2N2OS and a molecular weight of 331.27 g/mol. Its IUPAC name is 1-(4-tert-butylthiadiazol-5-yl)-2-(2,4-dichlorophenyl)ethanol.
| Compound Name | 1-(4-tert-butylthiadiazol-5-yl)-2-(2,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 105086800 |
| Molecular Formula | C14H16Cl2N2OS |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 1-(4-tert-butylthiadiazol-5-yl)-2-(2,4-dichlorophenyl)ethanol |
| SMILES | CC(C)(C)c1nnsc1C(O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2N2OS/c1-14(2,3)13-12(20-18-17-13)11(19)6-8-4-5-9(15)7-10(8)16/h4-5,7,11,19H,6H2,1-3H3 |
| InChIKey | OOVXJXKCOAUSEU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |