C14H18ClFN4S — CID 105295283
[1-(4-tert-butylthiadiazol-5-yl)-2-(2-chloro-4-fluorophenyl)ethyl]hydrazine (PubChem CID 105295283) has the molecular formula C14H18ClFN4S and a molecular weight of 328.84 g/mol. Its IUPAC name is [1-(4-tert-butylthiadiazol-5-yl)-2-(2-chloro-4-fluorophenyl)ethyl]hydrazine.
| Compound Name | [1-(4-tert-butylthiadiazol-5-yl)-2-(2-chloro-4-fluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105295283 |
| Molecular Formula | C14H18ClFN4S |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | [1-(4-tert-butylthiadiazol-5-yl)-2-(2-chloro-4-fluorophenyl)ethyl]hydrazine |
| SMILES | CC(C)(C)c1nnsc1C(Cc1ccc(F)cc1Cl)NN |
| InChI | InChI=1S/C14H18ClFN4S/c1-14(2,3)13-12(21-20-19-13)11(18-17)6-8-4-5-9(16)7-10(8)15/h4-5,7,11,18H,6,17H2,1-3H3 |
| InChIKey | JRCRYMMRUJUXSY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|