C15H21FN4S — CID 105340927
[1-(4-tert-butylthiadiazol-5-yl)-2-(4-fluoro-2-methylphenyl)ethyl]hydrazine (PubChem CID 105340927) has the molecular formula C15H21FN4S and a molecular weight of 308.43 g/mol. Its IUPAC name is [1-(4-tert-butylthiadiazol-5-yl)-2-(4-fluoro-2-methylphenyl)ethyl]hydrazine.
| Compound Name | [1-(4-tert-butylthiadiazol-5-yl)-2-(4-fluoro-2-methylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105340927 |
| Molecular Formula | C15H21FN4S |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | [1-(4-tert-butylthiadiazol-5-yl)-2-(4-fluoro-2-methylphenyl)ethyl]hydrazine |
| SMILES | Cc1cc(F)ccc1CC(NN)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C15H21FN4S/c1-9-7-11(16)6-5-10(9)8-12(18-17)13-14(15(2,3)4)19-20-21-13/h5-7,12,18H,8,17H2,1-4H3 |
| InChIKey | INJINYUGOPYTQR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|