C14H18Cl2N4S — CID 105296898
[1-(4-tert-butylthiadiazol-5-yl)-2-(3,4-dichlorophenyl)ethyl]hydrazine (PubChem CID 105296898) has the molecular formula C14H18Cl2N4S and a molecular weight of 345.30 g/mol. Its IUPAC name is [1-(4-tert-butylthiadiazol-5-yl)-2-(3,4-dichlorophenyl)ethyl]hydrazine.
| Compound Name | [1-(4-tert-butylthiadiazol-5-yl)-2-(3,4-dichlorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105296898 |
| Molecular Formula | C14H18Cl2N4S |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | [1-(4-tert-butylthiadiazol-5-yl)-2-(3,4-dichlorophenyl)ethyl]hydrazine |
| SMILES | CC(C)(C)c1nnsc1C(Cc1ccc(Cl)c(Cl)c1)NN |
| InChI | InChI=1S/C14H18Cl2N4S/c1-14(2,3)13-12(21-20-19-13)11(18-17)7-8-4-5-9(15)10(16)6-8/h4-6,11,18H,7,17H2,1-3H3 |
| InChIKey | LOVVJLPXQHHDBG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|