C15H12Cl4O — CID 63410533
1,3-bis(2,4-dichlorophenyl)propan-2-ol (PubChem CID 63410533) has the molecular formula C15H12Cl4O and a molecular weight of 350.07 g/mol. Its IUPAC name is 1,3-bis(2,4-dichlorophenyl)propan-2-ol.
| Compound Name | 1,3-bis(2,4-dichlorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 63410533 |
| Molecular Formula | C15H12Cl4O |
| Molecular Weight | 350.07 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 1,3-bis(2,4-dichlorophenyl)propan-2-ol |
| SMILES | OC(Cc1ccc(Cl)cc1Cl)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl4O/c16-11-3-1-9(14(18)7-11)5-13(20)6-10-2-4-12(17)8-15(10)19/h1-4,7-8,13,20H,5-6H2 |
| InChIKey | DUXFTAFWIWCANE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.07 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |