C12H12Cl2O — CID 63657112
1-(2,4-dichlorophenyl)hex-5-yn-2-ol (PubChem CID 63657112) has the molecular formula C12H12Cl2O and a molecular weight of 243.13 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)hex-5-yn-2-ol.
| Compound Name | 1-(2,4-dichlorophenyl)hex-5-yn-2-ol |
|---|---|
| PubChem CID | 63657112 |
| Molecular Formula | C12H12Cl2O |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)hex-5-yn-2-ol |
| SMILES | C#CCCC(O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2O/c1-2-3-4-11(15)7-9-5-6-10(13)8-12(9)14/h1,5-6,8,11,15H,3-4,7H2 |
| InChIKey | MKKYVAWNBJCPKR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|