C10H12Cl2O2 — CID 57073476
4-(2,4-dichlorophenyl)butane-1,2-diol (PubChem CID 57073476) has the molecular formula C10H12Cl2O2 and a molecular weight of 235.11 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)butane-1,2-diol.
| Compound Name | 4-(2,4-dichlorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 57073476 |
| Molecular Formula | C10H12Cl2O2 |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 4-(2,4-dichlorophenyl)butane-1,2-diol |
| SMILES | OCC(O)CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2O2/c11-8-3-1-7(10(12)5-8)2-4-9(14)6-13/h1,3,5,9,13-14H,2,4,6H2 |
| InChIKey | LYZWLQUECZURFY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |