C11H11Cl2N — CID 57027165
4-(2,4-dichlorophenyl)-2-methylbutanenitrile (PubChem CID 57027165) has the molecular formula C11H11Cl2N and a molecular weight of 228.12 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2-methylbutanenitrile.
| Compound Name | 4-(2,4-dichlorophenyl)-2-methylbutanenitrile |
|---|---|
| PubChem CID | 57027165 |
| Molecular Formula | C11H11Cl2N |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-2-methylbutanenitrile |
| SMILES | CC(C#N)CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2N/c1-8(7-14)2-3-9-4-5-10(12)6-11(9)13/h4-6,8H,2-3H2,1H3 |
| InChIKey | YUCGEFMWVJLVHC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |