C11H14Cl2O — CID 143735610
3-(2,4-dichlorophenyl)propanal;ethane (PubChem CID 143735610) has the molecular formula C11H14Cl2O and a molecular weight of 233.14 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)propanal;ethane.
| Compound Name | 3-(2,4-dichlorophenyl)propanal;ethane |
|---|---|
| PubChem CID | 143735610 |
| Molecular Formula | C11H14Cl2O |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 3-(2,4-dichlorophenyl)propanal;ethane |
| SMILES | CC.O=CCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2O.C2H6/c10-8-4-3-7(2-1-5-12)9(11)6-8;1-2/h3-6H,1-2H2;1-2H3 |
| InChIKey | ABVARBSWDSHEGH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|