C12H17Cl2NO2S — CID 43807626
2-(2,4-dichlorophenyl)-N-(2-ethylsulfonylethyl)ethanamine (PubChem CID 43807626) has the molecular formula C12H17Cl2NO2S and a molecular weight of 310.25 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(2-ethylsulfonylethyl)ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(2-ethylsulfonylethyl)ethanamine |
|---|---|
| PubChem CID | 43807626 |
| Molecular Formula | C12H17Cl2NO2S |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(2-ethylsulfonylethyl)ethanamine |
| SMILES | CCS(=O)(=O)CCNCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2NO2S/c1-2-18(16,17)8-7-15-6-5-10-3-4-11(13)9-12(10)14/h3-4,9,15H,2,5-8H2,1H3 |
| InChIKey | JOFNOSXFJQQIFF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|