C17H20Cl2N2O2S — CID 112985739
N-[4-[2-(2,4-dichlorophenyl)ethylamino]phenyl]propane-1-sulfonamide (PubChem CID 112985739) has the molecular formula C17H20Cl2N2O2S and a molecular weight of 387.33 g/mol. Its IUPAC name is N-[4-[2-(2,4-dichlorophenyl)ethylamino]phenyl]propane-1-sulfonamide.
| Compound Name | N-[4-[2-(2,4-dichlorophenyl)ethylamino]phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 112985739 |
| Molecular Formula | C17H20Cl2N2O2S |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-[4-[2-(2,4-dichlorophenyl)ethylamino]phenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(NCCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H20Cl2N2O2S/c1-2-11-24(22,23)21-16-7-5-15(6-8-16)20-10-9-13-3-4-14(18)12-17(13)19/h3-8,12,20-21H,2,9-11H2,1H3 |
| InChIKey | XCMCNTFPVZCBNA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |