C15H12Cl2F3N — CID 63536432
N-[2-(2,4-dichlorophenyl)ethyl]-4-(trifluoromethyl)aniline (PubChem CID 63536432) has the molecular formula C15H12Cl2F3N and a molecular weight of 334.17 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-4-(trifluoromethyl)aniline.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 63536432 |
| Molecular Formula | C15H12Cl2F3N |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccc(NCCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H12Cl2F3N/c16-12-4-1-10(14(17)9-12)7-8-21-13-5-2-11(3-6-13)15(18,19)20/h1-6,9,21H,7-8H2 |
| InChIKey | FKZHHYSCZFRRSH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |