C12H12Cl2N4 — CID 78929904
4-N-[2-(2,4-dichlorophenyl)ethyl]pyrimidine-4,6-diamine (PubChem CID 78929904) has the molecular formula C12H12Cl2N4 and a molecular weight of 283.16 g/mol. Its IUPAC name is 4-N-[2-(2,4-dichlorophenyl)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-(2,4-dichlorophenyl)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 78929904 |
| Molecular Formula | C12H12Cl2N4 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 4-N-[2-(2,4-dichlorophenyl)ethyl]pyrimidine-4,6-diamine |
| SMILES | Nc1cc(NCCc2ccc(Cl)cc2Cl)ncn1 |
| InChI | InChI=1S/C12H12Cl2N4/c13-9-2-1-8(10(14)5-9)3-4-16-12-6-11(15)17-7-18-12/h1-2,5-7H,3-4H2,(H3,15,16,17,18) |
| InChIKey | YRLVUNBOGDRXKP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |