C17H20Cl2N4 — CID 112856076
N-[2-(2,4-dichlorophenyl)ethyl]-6-piperidin-1-ylpyrimidin-4-amine (PubChem CID 112856076) has the molecular formula C17H20Cl2N4 and a molecular weight of 351.28 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-6-piperidin-1-ylpyrimidin-4-amine.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-6-piperidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112856076 |
| Molecular Formula | C17H20Cl2N4 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-6-piperidin-1-ylpyrimidin-4-amine |
| SMILES | Clc1ccc(CCNc2cc(N3CCCCC3)ncn2)c(Cl)c1 |
| InChI | InChI=1S/C17H20Cl2N4/c18-14-5-4-13(15(19)10-14)6-7-20-16-11-17(22-12-21-16)23-8-2-1-3-9-23/h4-5,10-12H,1-3,6-9H2,(H,20,21,22) |
| InChIKey | MKJBXKPYAJAISU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |