C18H22Cl2N4 — CID 112901497
2-(azepan-1-yl)-N-[2-(2,4-dichlorophenyl)ethyl]pyrimidin-4-amine (PubChem CID 112901497) has the molecular formula C18H22Cl2N4 and a molecular weight of 365.31 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-[2-(2,4-dichlorophenyl)ethyl]pyrimidin-4-amine.
| Compound Name | 2-(azepan-1-yl)-N-[2-(2,4-dichlorophenyl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 112901497 |
| Molecular Formula | C18H22Cl2N4 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-(azepan-1-yl)-N-[2-(2,4-dichlorophenyl)ethyl]pyrimidin-4-amine |
| SMILES | Clc1ccc(CCNc2ccnc(N3CCCCCC3)n2)c(Cl)c1 |
| InChI | InChI=1S/C18H22Cl2N4/c19-15-6-5-14(16(20)13-15)7-9-21-17-8-10-22-18(23-17)24-11-3-1-2-4-12-24/h5-6,8,10,13H,1-4,7,9,11-12H2,(H,21,22,23) |
| InChIKey | WVAZBWRJXQZSKH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |