C19H26N4 — CID 112899263
2-(azepan-1-yl)-N-(3-phenylpropyl)pyrimidin-4-amine (PubChem CID 112899263) has the molecular formula C19H26N4 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-(3-phenylpropyl)pyrimidin-4-amine.
| Compound Name | 2-(azepan-1-yl)-N-(3-phenylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112899263 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 2-(azepan-1-yl)-N-(3-phenylpropyl)pyrimidin-4-amine |
| SMILES | c1ccc(CCCNc2ccnc(N3CCCCCC3)n2)cc1 |
| InChI | InChI=1S/C19H26N4/c1-2-7-16-23(15-6-1)19-21-14-12-18(22-19)20-13-8-11-17-9-4-3-5-10-17/h3-5,9-10,12,14H,1-2,6-8,11,13,15-16H2,(H,20,21,22) |
| InChIKey | MQCRRCMFQOJRHB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|