C12H18N4O2 — CID 122048200
3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]propanoic acid (PubChem CID 122048200) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]propanoic acid.
| Compound Name | 3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 122048200 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3-[(2-piperidin-1-ylpyrimidin-4-yl)amino]propanoic acid |
| SMILES | O=C(O)CCNc1ccnc(N2CCCCC2)n1 |
| InChI | InChI=1S/C12H18N4O2/c17-11(18)5-7-13-10-4-6-14-12(15-10)16-8-2-1-3-9-16/h4,6H,1-3,5,7-9H2,(H,17,18)(H,13,14,15) |
| InChIKey | DOKDRCLDCFGHHV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |