C13H13Cl2N3 — CID 61224338
N-[2-(2,4-dichlorophenyl)ethyl]-6-methylpyrimidin-4-amine (PubChem CID 61224338) has the molecular formula C13H13Cl2N3 and a molecular weight of 282.17 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-6-methylpyrimidin-4-amine.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 61224338 |
| Molecular Formula | C13H13Cl2N3 |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(NCCc2ccc(Cl)cc2Cl)ncn1 |
| InChI | InChI=1S/C13H13Cl2N3/c1-9-6-13(18-8-17-9)16-5-4-10-2-3-11(14)7-12(10)15/h2-3,6-8H,4-5H2,1H3,(H,16,17,18) |
| InChIKey | WLSVIQHFDFIUKM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |