C16H19Cl2N5O2S — CID 122327483
2,5-dichloro-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 122327483) has the molecular formula C16H19Cl2N5O2S and a molecular weight of 416.33 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122327483 |
| Molecular Formula | C16H19Cl2N5O2S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 2,5-dichloro-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1cc(N2CCCC2)ncn1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H19Cl2N5O2S/c17-12-3-4-13(18)14(9-12)26(24,25)22-6-5-19-15-10-16(21-11-20-15)23-7-1-2-8-23/h3-4,9-11,22H,1-2,5-8H2,(H,19,20,21) |
| InChIKey | VYJJVAKZMVKVQK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|