C19H26N6O3S — CID 122327735
N-[3-methyl-4-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethylsulfamoyl]phenyl]acetamide (PubChem CID 122327735) has the molecular formula C19H26N6O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[3-methyl-4-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[3-methyl-4-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 122327735 |
| Molecular Formula | C19H26N6O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-[3-methyl-4-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCNc2cc(N3CCCC3)ncn2)c(C)c1 |
| InChI | InChI=1S/C19H26N6O3S/c1-14-11-16(24-15(2)26)5-6-17(14)29(27,28)23-8-7-20-18-12-19(22-13-21-18)25-9-3-4-10-25/h5-6,11-13,23H,3-4,7-10H2,1-2H3,(H,24,26)(H,20,21,22) |
| InChIKey | GEJYQZYJCJUNJV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|