C20H25N7O3S — CID 122293238
N-[4-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethylsulfamoyl]-3-methylphenyl]acetamide (PubChem CID 122293238) has the molecular formula C20H25N7O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is N-[4-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethylsulfamoyl]-3-methylphenyl]acetamide.
| Compound Name | N-[4-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethylsulfamoyl]-3-methylphenyl]acetamide |
|---|---|
| PubChem CID | 122293238 |
| Molecular Formula | C20H25N7O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[4-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethylsulfamoyl]-3-methylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCNc2ccc(-n3nc(C)cc3C)nn2)c(C)c1 |
| InChI | InChI=1S/C20H25N7O3S/c1-13-11-17(23-16(4)28)5-6-18(13)31(29,30)22-10-9-21-19-7-8-20(25-24-19)27-15(3)12-14(2)26-27/h5-8,11-12,22H,9-10H2,1-4H3,(H,21,24)(H,23,28) |
| InChIKey | ORKMYSABCORINZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|