C18H23N7O3S2 — CID 122293252
N-[[5-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide (PubChem CID 122293252) has the molecular formula C18H23N7O3S2 and a molecular weight of 449.56 g/mol. Its IUPAC name is N-[[5-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 122293252 |
| Molecular Formula | C18H23N7O3S2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N-[[5-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)NCCNc2ccc(-n3nc(C)cc3C)nn2)s1 |
| InChI | InChI=1S/C18H23N7O3S2/c1-12-10-13(2)25(24-12)17-6-5-16(22-23-17)19-8-9-21-30(27,28)18-7-4-15(29-18)11-20-14(3)26/h4-7,10,21H,8-9,11H2,1-3H3,(H,19,22)(H,20,26) |
| InChIKey | ZDKDZNYEBLELDW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|