C18H21N7O3S2 — CID 122289533
N-[[5-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide (PubChem CID 122289533) has the molecular formula C18H21N7O3S2 and a molecular weight of 447.55 g/mol. Its IUPAC name is N-[[5-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 122289533 |
| Molecular Formula | C18H21N7O3S2 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-[[5-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)NCCNc2ccc(Nc3cccnc3)nn2)s1 |
| InChI | InChI=1S/C18H21N7O3S2/c1-13(26)21-12-15-4-7-18(29-15)30(27,28)22-10-9-20-16-5-6-17(25-24-16)23-14-3-2-8-19-11-14/h2-8,11,22H,9-10,12H2,1H3,(H,20,24)(H,21,26)(H,23,25) |
| InChIKey | NYTXWNRFNGDEJA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|