C17H16N8O2S2 — CID 122289537
N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 122289537) has the molecular formula C17H16N8O2S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 122289537 |
| Molecular Formula | C17H16N8O2S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCNc1ccc(Nc2cccnc2)nn1)c1cccc2nsnc12 |
| InChI | InChI=1S/C17H16N8O2S2/c26-29(27,14-5-1-4-13-17(14)25-28-24-13)20-10-9-19-15-6-7-16(23-22-15)21-12-3-2-8-18-11-12/h1-8,11,20H,9-10H2,(H,19,22)(H,21,23) |
| InChIKey | QDRRYADYXBBNRC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|